C23H35N3O5S — CID 58783471
tert-butyl N-[(2R)-3-(cyclohexylmethylsulfanyl)-1-[[(1R)-1-(4-nitrophenyl)ethyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 58783471) has the molecular formula C23H35N3O5S and a molecular weight of 465.62 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-(cyclohexylmethylsulfanyl)-1-[[(1R)-1-(4-nitrophenyl)ethyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-(cyclohexylmethylsulfanyl)-1-[[(1R)-1-(4-nitrophenyl)ethyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 58783471 |
| Molecular Formula | C23H35N3O5S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | tert-butyl N-[(2R)-3-(cyclohexylmethylsulfanyl)-1-[[(1R)-1-(4-nitrophenyl)ethyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)[C@H](CSCC1CCCCC1)NC(=O)OC(C)(C)C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H35N3O5S/c1-16(18-10-12-19(13-11-18)26(29)30)24-21(27)20(25-22(28)31-23(2,3)4)15-32-14-17-8-6-5-7-9-17/h10-13,16-17,20H,5-9,14-15H2,1-4H3,(H,24,27)(H,25,28)/t16-,20+/m1/s1 |
| InChIKey | FMKJELMUAQAGJC-UZLBHIALSA-N |
| XLogP | 4.98 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|