C23H35N3O4S — CID 87823113
tert-butyl N-[(2R)-3-cyclohexyl-1-[[(1R)-1-(4-nitrophenyl)ethyl]amino]-1-sulfanylidenebutan-2-yl]carbamate (PubChem CID 87823113) has the molecular formula C23H35N3O4S and a molecular weight of 449.62 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-cyclohexyl-1-[[(1R)-1-(4-nitrophenyl)ethyl]amino]-1-sulfanylidenebutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-cyclohexyl-1-[[(1R)-1-(4-nitrophenyl)ethyl]amino]-1-sulfanylidenebutan-2-yl]carbamate |
|---|---|
| PubChem CID | 87823113 |
| Molecular Formula | C23H35N3O4S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | tert-butyl N-[(2R)-3-cyclohexyl-1-[[(1R)-1-(4-nitrophenyl)ethyl]amino]-1-sulfanylidenebutan-2-yl]carbamate |
| SMILES | CC(C1CCCCC1)[C@@H](NC(=O)OC(C)(C)C)C(=S)N[C@H](C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H35N3O4S/c1-15(17-9-7-6-8-10-17)20(25-22(27)30-23(3,4)5)21(31)24-16(2)18-11-13-19(14-12-18)26(28)29/h11-17,20H,6-10H2,1-5H3,(H,24,31)(H,25,27)/t15?,16-,20-/m1/s1 |
| InChIKey | QAUBIAMHRVRAKS-KOIGGSBLSA-N |
| XLogP | 5.68 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|