C27H41N5O5S2 — CID 59794461
(4R)-3-N-tert-butyl-4-N-[(2R)-3-(cyclohexylmethylsulfanyl)-1-[[(1R)-1-(4-nitrophenyl)ethyl]amino]-1-oxopropan-2-yl]-1,3-thiazolidine-3,4-dicarboxamide (PubChem CID 59794461) has the molecular formula C27H41N5O5S2 and a molecular weight of 579.79 g/mol. Its IUPAC name is (4R)-3-N-tert-butyl-4-N-[(2R)-3-(cyclohexylmethylsulfanyl)-1-[[(1R)-1-(4-nitrophenyl)ethyl]amino]-1-oxopropan-2-yl]-1,3-thiazolidine-3,4-dicarboxamide.
| Compound Name | (4R)-3-N-tert-butyl-4-N-[(2R)-3-(cyclohexylmethylsulfanyl)-1-[[(1R)-1-(4-nitrophenyl)ethyl]amino]-1-oxopropan-2-yl]-1,3-thiazolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 59794461 |
| Molecular Formula | C27H41N5O5S2 |
| Molecular Weight | 579.79 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | (4R)-3-N-tert-butyl-4-N-[(2R)-3-(cyclohexylmethylsulfanyl)-1-[[(1R)-1-(4-nitrophenyl)ethyl]amino]-1-oxopropan-2-yl]-1,3-thiazolidine-3,4-dicarboxamide |
| SMILES | C[C@@H](NC(=O)[C@H](CSCC1CCCCC1)NC(=O)[C@@H]1CSCN1C(=O)NC(C)(C)C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H41N5O5S2/c1-18(20-10-12-21(13-11-20)32(36)37)28-24(33)22(15-38-14-19-8-6-5-7-9-19)29-25(34)23-16-39-17-31(23)26(35)30-27(2,3)4/h10-13,18-19,22-23H,5-9,14-17H2,1-4H3,(H,28,33)(H,29,34)(H,30,35)/t18-,22+,23+/m1/s1 |
| InChIKey | QJMFNLAGUVHJNS-LEOXJPRUSA-N |
| XLogP | 4.45 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|