C17H24N4O4S — CID 72723500
(2S)-1-[(2S)-2-amino-4-methylsulfanylbutanoyl]-N-[(4-nitrophenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 72723500) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-amino-4-methylsulfanylbutanoyl]-N-[(4-nitrophenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-amino-4-methylsulfanylbutanoyl]-N-[(4-nitrophenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 72723500 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (2S)-1-[(2S)-2-amino-4-methylsulfanylbutanoyl]-N-[(4-nitrophenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | CSCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)NCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H24N4O4S/c1-26-10-8-14(18)17(23)20-9-2-3-15(20)16(22)19-11-12-4-6-13(7-5-12)21(24)25/h4-7,14-15H,2-3,8-11,18H2,1H3,(H,19,22)/t14-,15-/m0/s1 |
| InChIKey | DDAQEOKFEGQQSK-GJZGRUSLSA-N |
| XLogP | 1.28 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|