C25H38N4O5S — CID 10577526
N-tert-butyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]nonanamide (PubChem CID 10577526) has the molecular formula C25H38N4O5S and a molecular weight of 506.67 g/mol. Its IUPAC name is N-tert-butyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]nonanamide.
| Compound Name | N-tert-butyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]nonanamide |
|---|---|
| PubChem CID | 10577526 |
| Molecular Formula | C25H38N4O5S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | N-tert-butyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]nonanamide |
| SMILES | CCCCCCCC(C(=O)NC(C)(C)C)N1C(=O)[C@H](CS)NC(=O)[C@@H]1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H38N4O5S/c1-5-6-7-8-9-10-20(23(31)27-25(2,3)4)28-21(22(30)26-19(16-35)24(28)32)15-17-11-13-18(14-12-17)29(33)34/h11-14,19-21,35H,5-10,15-16H2,1-4H3,(H,26,30)(H,27,31)/t19-,20?,21-/m0/s1 |
| InChIKey | WQARHIDTTAFNCG-YSTUSHMSSA-N |
| XLogP | 3.41 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|