C25H33N5O4 — CID 4692200
N'-(4-butylphenyl)-N-[2-[4-[(4-nitrophenyl)methyl]piperazin-1-yl]ethyl]oxamide (PubChem CID 4692200) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is N'-(4-butylphenyl)-N-[2-[4-[(4-nitrophenyl)methyl]piperazin-1-yl]ethyl]oxamide.
| Compound Name | N'-(4-butylphenyl)-N-[2-[4-[(4-nitrophenyl)methyl]piperazin-1-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 4692200 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | N'-(4-butylphenyl)-N-[2-[4-[(4-nitrophenyl)methyl]piperazin-1-yl]ethyl]oxamide |
| SMILES | CCCCc1ccc(NC(=O)C(=O)NCCN2CCN(Cc3ccc([N+](=O)[O-])cc3)CC2)cc1 |
| InChI | InChI=1S/C25H33N5O4/c1-2-3-4-20-5-9-22(10-6-20)27-25(32)24(31)26-13-14-28-15-17-29(18-16-28)19-21-7-11-23(12-8-21)30(33)34/h5-12H,2-4,13-19H2,1H3,(H,26,31)(H,27,32) |
| InChIKey | HABZPJHNDIWXJQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|