C31H53NO8Si — CID 154314251
[1-[tert-butyl(dimethyl)silyl]oxy-13-(oxan-2-yloxy)tridecan-3-yl] (4-nitrophenyl) carbonate (PubChem CID 154314251) has the molecular formula C31H53NO8Si and a molecular weight of 595.85 g/mol. Its IUPAC name is [1-[tert-butyl(dimethyl)silyl]oxy-13-(oxan-2-yloxy)tridecan-3-yl] (4-nitrophenyl) carbonate.
| Compound Name | [1-[tert-butyl(dimethyl)silyl]oxy-13-(oxan-2-yloxy)tridecan-3-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 154314251 |
| Molecular Formula | C31H53NO8Si |
| Molecular Weight | 595.85 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | [1-[tert-butyl(dimethyl)silyl]oxy-13-(oxan-2-yloxy)tridecan-3-yl] (4-nitrophenyl) carbonate |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(CCCCCCCCCCOC1CCCCO1)OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H53NO8Si/c1-31(2,3)41(4,5)38-25-22-27(39-30(33)40-28-20-18-26(19-21-28)32(34)35)16-12-10-8-6-7-9-11-14-23-36-29-17-13-15-24-37-29/h18-21,27,29H,6-17,22-25H2,1-5H3 |
| InChIKey | LDIPVJFMTPHIIO-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.85 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|