C22H21Cl2N3O5 — CID 58932628
[(2S)-1-cyclopentyl-3-(5,6-dichlorobenzimidazol-1-yl)propan-2-yl] (4-nitrophenyl) carbonate (PubChem CID 58932628) has the molecular formula C22H21Cl2N3O5 and a molecular weight of 478.33 g/mol. Its IUPAC name is [(2S)-1-cyclopentyl-3-(5,6-dichlorobenzimidazol-1-yl)propan-2-yl] (4-nitrophenyl) carbonate.
| Compound Name | [(2S)-1-cyclopentyl-3-(5,6-dichlorobenzimidazol-1-yl)propan-2-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 58932628 |
| Molecular Formula | C22H21Cl2N3O5 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | [(2S)-1-cyclopentyl-3-(5,6-dichlorobenzimidazol-1-yl)propan-2-yl] (4-nitrophenyl) carbonate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)O[C@@H](CC1CCCC1)Cn1cnc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C22H21Cl2N3O5/c23-18-10-20-21(11-19(18)24)26(13-25-20)12-17(9-14-3-1-2-4-14)32-22(28)31-16-7-5-15(6-8-16)27(29)30/h5-8,10-11,13-14,17H,1-4,9,12H2/t17-/m0/s1 |
| InChIKey | GMTFZFRIEGEBKM-KRWDZBQOSA-N |
| XLogP | 6.42 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|