C32H50N4O5 — CID 90737365
(2S)-2-[(2-methylpropylamino)-[(2R)-4-methyl-2-(2-pyrrolidin-1-ylacetyl)pentanoyl]amino]-N-(oxan-2-yloxy)-5-phenylpent-4-enamide (PubChem CID 90737365) has the molecular formula C32H50N4O5 and a molecular weight of 570.78 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropylamino)-[(2R)-4-methyl-2-(2-pyrrolidin-1-ylacetyl)pentanoyl]amino]-N-(oxan-2-yloxy)-5-phenylpent-4-enamide.
| Compound Name | (2S)-2-[(2-methylpropylamino)-[(2R)-4-methyl-2-(2-pyrrolidin-1-ylacetyl)pentanoyl]amino]-N-(oxan-2-yloxy)-5-phenylpent-4-enamide |
|---|---|
| PubChem CID | 90737365 |
| Molecular Formula | C32H50N4O5 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.38 |
| IUPAC Name | (2S)-2-[(2-methylpropylamino)-[(2R)-4-methyl-2-(2-pyrrolidin-1-ylacetyl)pentanoyl]amino]-N-(oxan-2-yloxy)-5-phenylpent-4-enamide |
| SMILES | CC(C)CNN(C(=O)C(CC(C)C)C(=O)CN1CCCC1)[C@@H](CC=Cc1ccccc1)C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C32H50N4O5/c1-24(2)21-27(29(37)23-35-18-9-10-19-35)32(39)36(33-22-25(3)4)28(16-12-15-26-13-6-5-7-14-26)31(38)34-41-30-17-8-11-20-40-30/h5-7,12-15,24-25,27-28,30,33H,8-11,16-23H2,1-4H3,(H,34,38)/t27?,28-,30?/m0/s1 |
| InChIKey | BXXCIXWSVMYEOV-JWAPEYQUSA-N |
| XLogP | 4.35 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|