C26H36N4O6 — CID 160535226
(2R,3S)-N-(2,6-dioxo-1,3-diazinan-1-yl)-2-(2-methylpropyl)-N'-(oxan-2-yloxy)-3-[(E)-3-phenylprop-2-enyl]butanediamide (PubChem CID 160535226) has the molecular formula C26H36N4O6 and a molecular weight of 500.60 g/mol. Its IUPAC name is (2R,3S)-N-(2,6-dioxo-1,3-diazinan-1-yl)-2-(2-methylpropyl)-N'-(oxan-2-yloxy)-3-[(E)-3-phenylprop-2-enyl]butanediamide.
| Compound Name | (2R,3S)-N-(2,6-dioxo-1,3-diazinan-1-yl)-2-(2-methylpropyl)-N'-(oxan-2-yloxy)-3-[(E)-3-phenylprop-2-enyl]butanediamide |
|---|---|
| PubChem CID | 160535226 |
| Molecular Formula | C26H36N4O6 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (2R,3S)-N-(2,6-dioxo-1,3-diazinan-1-yl)-2-(2-methylpropyl)-N'-(oxan-2-yloxy)-3-[(E)-3-phenylprop-2-enyl]butanediamide |
| SMILES | CC(C)C[C@@H](C(=O)NN1C(=O)CCNC1=O)[C@H](C/C=C/c1ccccc1)C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C26H36N4O6/c1-18(2)17-21(24(32)28-30-22(31)14-15-27-26(30)34)20(12-8-11-19-9-4-3-5-10-19)25(33)29-36-23-13-6-7-16-35-23/h3-5,8-11,18,20-21,23H,6-7,12-17H2,1-2H3,(H,27,34)(H,28,32)(H,29,33)/b11-8+/t20-,21+,23?/m0/s1 |
| InChIKey | QWBJNBPIJIDKAW-IZSLRUSBSA-N |
| XLogP | 2.92 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|