C21H28N4O5 — CID 173203065
(2R,3S)-N-(2,6-dioxo-1,3-diazinan-1-yl)-N'-hydroxy-2-(2-methylpropyl)-3-(3-phenylprop-2-enyl)butanediamide (PubChem CID 173203065) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is (2R,3S)-N-(2,6-dioxo-1,3-diazinan-1-yl)-N'-hydroxy-2-(2-methylpropyl)-3-(3-phenylprop-2-enyl)butanediamide.
| Compound Name | (2R,3S)-N-(2,6-dioxo-1,3-diazinan-1-yl)-N'-hydroxy-2-(2-methylpropyl)-3-(3-phenylprop-2-enyl)butanediamide |
|---|---|
| PubChem CID | 173203065 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (2R,3S)-N-(2,6-dioxo-1,3-diazinan-1-yl)-N'-hydroxy-2-(2-methylpropyl)-3-(3-phenylprop-2-enyl)butanediamide |
| SMILES | CC(C)C[C@@H](C(=O)NN1C(=O)CCNC1=O)C(CC=Cc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C21H28N4O5/c1-14(2)13-17(19(27)23-25-18(26)11-12-22-21(25)29)16(20(28)24-30)10-6-9-15-7-4-3-5-8-15/h3-9,14,16-17,30H,10-13H2,1-2H3,(H,22,29)(H,23,27)(H,24,28)/t16?,17-/m1/s1 |
| InChIKey | JJGNELPGJOZXFJ-ZYMOGRSISA-N |
| XLogP | 1.85 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|