C29H38N4O8S — CID 54344201
(2R)-5-methyl-3-[(N-methylsulfonyl-4-nitroanilino)carbamoyl]-N-[(2S)-oxan-2-yl]oxy-2-(3-phenylprop-2-enyl)hexanamide (PubChem CID 54344201) has the molecular formula C29H38N4O8S and a molecular weight of 602.71 g/mol. Its IUPAC name is (2R)-5-methyl-3-[(N-methylsulfonyl-4-nitroanilino)carbamoyl]-N-[(2S)-oxan-2-yl]oxy-2-(3-phenylprop-2-enyl)hexanamide.
| Compound Name | (2R)-5-methyl-3-[(N-methylsulfonyl-4-nitroanilino)carbamoyl]-N-[(2S)-oxan-2-yl]oxy-2-(3-phenylprop-2-enyl)hexanamide |
|---|---|
| PubChem CID | 54344201 |
| Molecular Formula | C29H38N4O8S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | (2R)-5-methyl-3-[(N-methylsulfonyl-4-nitroanilino)carbamoyl]-N-[(2S)-oxan-2-yl]oxy-2-(3-phenylprop-2-enyl)hexanamide |
| SMILES | CC(C)CC(C(=O)NN(c1ccc([N+](=O)[O-])cc1)S(C)(=O)=O)[C@@H](CC=Cc1ccccc1)C(=O)NO[C@H]1CCCCO1 |
| InChI | InChI=1S/C29H38N4O8S/c1-21(2)20-26(28(34)30-32(42(3,38)39)23-15-17-24(18-16-23)33(36)37)25(13-9-12-22-10-5-4-6-11-22)29(35)31-41-27-14-7-8-19-40-27/h4-6,9-12,15-18,21,25-27H,7-8,13-14,19-20H2,1-3H3,(H,30,34)(H,31,35)/t25-,26?,27+/m1/s1 |
| InChIKey | UBCXYHRAMJSMLP-HXMJJLHYSA-N |
| XLogP | 4.35 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|