C30H41N3O6S — CID 54489304
(2R)-3-[[benzyl(methylsulfonyl)amino]carbamoyl]-5-methyl-N-[(2S)-oxan-2-yl]oxy-2-(3-phenylprop-2-enyl)hexanamide (PubChem CID 54489304) has the molecular formula C30H41N3O6S and a molecular weight of 571.74 g/mol. Its IUPAC name is (2R)-3-[[benzyl(methylsulfonyl)amino]carbamoyl]-5-methyl-N-[(2S)-oxan-2-yl]oxy-2-(3-phenylprop-2-enyl)hexanamide.
| Compound Name | (2R)-3-[[benzyl(methylsulfonyl)amino]carbamoyl]-5-methyl-N-[(2S)-oxan-2-yl]oxy-2-(3-phenylprop-2-enyl)hexanamide |
|---|---|
| PubChem CID | 54489304 |
| Molecular Formula | C30H41N3O6S |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | (2R)-3-[[benzyl(methylsulfonyl)amino]carbamoyl]-5-methyl-N-[(2S)-oxan-2-yl]oxy-2-(3-phenylprop-2-enyl)hexanamide |
| SMILES | CC(C)CC(C(=O)NN(Cc1ccccc1)S(C)(=O)=O)[C@@H](CC=Cc1ccccc1)C(=O)NO[C@H]1CCCCO1 |
| InChI | InChI=1S/C30H41N3O6S/c1-23(2)21-27(29(34)31-33(40(3,36)37)22-25-15-8-5-9-16-25)26(18-12-17-24-13-6-4-7-14-24)30(35)32-39-28-19-10-11-20-38-28/h4-9,12-17,23,26-28H,10-11,18-22H2,1-3H3,(H,31,34)(H,32,35)/t26-,27?,28+/m1/s1 |
| InChIKey | XUPAXMVRBBYZIF-UNQNHFTRSA-N |
| XLogP | 4.44 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|