C25H39N3O4 — CID 150531433
(2S,3R)-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)-3-[(propan-2-ylamino)carbamoyl]hexanamide (PubChem CID 150531433) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is (2S,3R)-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)-3-[(propan-2-ylamino)carbamoyl]hexanamide.
| Compound Name | (2S,3R)-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)-3-[(propan-2-ylamino)carbamoyl]hexanamide |
|---|---|
| PubChem CID | 150531433 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | (2S,3R)-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)-3-[(propan-2-ylamino)carbamoyl]hexanamide |
| SMILES | CC(C)C[C@@H](C(=O)NNC(C)C)[C@H](CC=Cc1ccccc1)C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C25H39N3O4/c1-18(2)17-22(24(29)27-26-19(3)4)21(14-10-13-20-11-6-5-7-12-20)25(30)28-32-23-15-8-9-16-31-23/h5-7,10-13,18-19,21-23,26H,8-9,14-17H2,1-4H3,(H,27,29)(H,28,30)/t21-,22+,23?/m0/s1 |
| InChIKey | IDXXCSUCROKMNE-ZVTBYLAHSA-N |
| XLogP | 3.97 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|