C31H41N3O6S — CID 173231659
(2S)-2-[(2R)-3-cyclopentyl-1-(2-methylsulfonyl-2-phenylhydrazinyl)-1-oxopropan-2-yl]-N-(oxan-2-yloxy)-5-phenylpent-4-enamide (PubChem CID 173231659) has the molecular formula C31H41N3O6S and a molecular weight of 583.75 g/mol. Its IUPAC name is (2S)-2-[(2R)-3-cyclopentyl-1-(2-methylsulfonyl-2-phenylhydrazinyl)-1-oxopropan-2-yl]-N-(oxan-2-yloxy)-5-phenylpent-4-enamide.
| Compound Name | (2S)-2-[(2R)-3-cyclopentyl-1-(2-methylsulfonyl-2-phenylhydrazinyl)-1-oxopropan-2-yl]-N-(oxan-2-yloxy)-5-phenylpent-4-enamide |
|---|---|
| PubChem CID | 173231659 |
| Molecular Formula | C31H41N3O6S |
| Molecular Weight | 583.75 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | (2S)-2-[(2R)-3-cyclopentyl-1-(2-methylsulfonyl-2-phenylhydrazinyl)-1-oxopropan-2-yl]-N-(oxan-2-yloxy)-5-phenylpent-4-enamide |
| SMILES | CS(=O)(=O)N(NC(=O)[C@H](CC1CCCC1)[C@H](CC=Cc1ccccc1)C(=O)NOC1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C31H41N3O6S/c1-41(37,38)34(26-18-6-3-7-19-26)32-30(35)28(23-25-15-8-9-16-25)27(20-12-17-24-13-4-2-5-14-24)31(36)33-40-29-21-10-11-22-39-29/h2-7,12-14,17-19,25,27-29H,8-11,15-16,20-23H2,1H3,(H,32,35)(H,33,36)/t27-,28+,29?/m0/s1 |
| InChIKey | VJFAQGILLZTNJZ-POZJPKTBSA-N |
| XLogP | 4.97 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.75 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|