C21H35N3O6 — CID 87783412
tert-butyl 2-[3-cyclopentylpropanoyl-(morpholine-4-carbonylamino)amino]-4-oxobutanoate (PubChem CID 87783412) has the molecular formula C21H35N3O6 and a molecular weight of 425.53 g/mol. Its IUPAC name is tert-butyl 2-[3-cyclopentylpropanoyl-(morpholine-4-carbonylamino)amino]-4-oxobutanoate.
| Compound Name | tert-butyl 2-[3-cyclopentylpropanoyl-(morpholine-4-carbonylamino)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 87783412 |
| Molecular Formula | C21H35N3O6 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | tert-butyl 2-[3-cyclopentylpropanoyl-(morpholine-4-carbonylamino)amino]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)C(CC=O)N(NC(=O)N1CCOCC1)C(=O)CCC1CCCC1 |
| InChI | InChI=1S/C21H35N3O6/c1-21(2,3)30-19(27)17(10-13-25)24(18(26)9-8-16-6-4-5-7-16)22-20(28)23-11-14-29-15-12-23/h13,16-17H,4-12,14-15H2,1-3H3,(H,22,28) |
| InChIKey | LOXFEMRTTOIMJL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|