C38H45N3O6 — CID 91078487
tert-butyl (2S)-2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-(4-methylpentanoyl)amino]-5-phenylpent-4-enoate (PubChem CID 91078487) has the molecular formula C38H45N3O6 and a molecular weight of 639.79 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-(4-methylpentanoyl)amino]-5-phenylpent-4-enoate.
| Compound Name | tert-butyl (2S)-2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-(4-methylpentanoyl)amino]-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 91078487 |
| Molecular Formula | C38H45N3O6 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | tert-butyl (2S)-2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-(4-methylpentanoyl)amino]-5-phenylpent-4-enoate |
| SMILES | CC(C)CCC(=O)N(NC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](CC=Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H45N3O6/c1-26(2)22-23-35(43)41(33(36(44)47-38(3,4)5)21-13-16-27-14-7-6-8-15-27)40-34(42)24-39-37(45)46-25-32-30-19-11-9-17-28(30)29-18-10-12-20-31(29)32/h6-20,26,32-33H,21-25H2,1-5H3,(H,39,45)(H,40,42)/t33-/m0/s1 |
| InChIKey | DZUZYHXGXLRDEC-XIFFEERXSA-N |
| XLogP | 6.63 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|