C34H37NO7 — CID 165053014
1-O-tert-butyl 4-O-(9H-fluoren-9-ylmethyl) 2-[3-oxo-3-[(2-oxo-2-phenylmethoxyethyl)amino]propyl]butanedioate (PubChem CID 165053014) has the molecular formula C34H37NO7 and a molecular weight of 571.67 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-(9H-fluoren-9-ylmethyl) 2-[3-oxo-3-[(2-oxo-2-phenylmethoxyethyl)amino]propyl]butanedioate.
| Compound Name | 1-O-tert-butyl 4-O-(9H-fluoren-9-ylmethyl) 2-[3-oxo-3-[(2-oxo-2-phenylmethoxyethyl)amino]propyl]butanedioate |
|---|---|
| PubChem CID | 165053014 |
| Molecular Formula | C34H37NO7 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | 1-O-tert-butyl 4-O-(9H-fluoren-9-ylmethyl) 2-[3-oxo-3-[(2-oxo-2-phenylmethoxyethyl)amino]propyl]butanedioate |
| SMILES | CC(C)(C)OC(=O)C(CCC(=O)NCC(=O)OCc1ccccc1)CC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H37NO7/c1-34(2,3)42-33(39)24(17-18-30(36)35-20-32(38)40-21-23-11-5-4-6-12-23)19-31(37)41-22-29-27-15-9-7-13-25(27)26-14-8-10-16-28(26)29/h4-16,24,29H,17-22H2,1-3H3,(H,35,36) |
| InChIKey | PYUKVXAOSWVDKZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|