C31H32N2O6 — CID 71489840
tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(4-formylanilino)-5-oxopentanoate (PubChem CID 71489840) has the molecular formula C31H32N2O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(4-formylanilino)-5-oxopentanoate.
| Compound Name | tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(4-formylanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 71489840 |
| Molecular Formula | C31H32N2O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(4-formylanilino)-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)Nc1ccc(C=O)cc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H32N2O6/c1-31(2,3)39-29(36)27(16-17-28(35)32-21-14-12-20(18-34)13-15-21)33-30(37)38-19-26-24-10-6-4-8-22(24)23-9-5-7-11-25(23)26/h4-15,18,26-27H,16-17,19H2,1-3H3,(H,32,35)(H,33,37)/t27-/m0/s1 |
| InChIKey | BXYBTJGQLJHTAD-MHZLTWQESA-N |
| XLogP | 5.47 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|