C27H42N2O3 — CID 174427841
tert-butyl (E,2S)-2-[1-[(2-methylpropylamino)-propanoylamino]cyclopentyl]-5-phenylpent-4-enoate (PubChem CID 174427841) has the molecular formula C27H42N2O3 and a molecular weight of 442.64 g/mol. Its IUPAC name is tert-butyl (E,2S)-2-[1-[(2-methylpropylamino)-propanoylamino]cyclopentyl]-5-phenylpent-4-enoate.
| Compound Name | tert-butyl (E,2S)-2-[1-[(2-methylpropylamino)-propanoylamino]cyclopentyl]-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 174427841 |
| Molecular Formula | C27H42N2O3 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | tert-butyl (E,2S)-2-[1-[(2-methylpropylamino)-propanoylamino]cyclopentyl]-5-phenylpent-4-enoate |
| SMILES | CCC(=O)N(NCC(C)C)C1([C@H](C/C=C/c2ccccc2)C(=O)OC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C27H42N2O3/c1-7-24(30)29(28-20-21(2)3)27(18-11-12-19-27)23(25(31)32-26(4,5)6)17-13-16-22-14-9-8-10-15-22/h8-10,13-16,21,23,28H,7,11-12,17-20H2,1-6H3/b16-13+/t23-/m1/s1 |
| InChIKey | ZDAGXXGMBDFHDX-HRNYAPDYSA-N |
| XLogP | 5.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|