C20H33N5O5S — CID 151789335
(2S,3R)-N-hydroxy-5-methyl-3-[[2-methylpropyl(methylsulfonyl)amino]carbamoyl]-2-(3-pyrimidin-5-ylprop-2-enyl)hexanamide (PubChem CID 151789335) has the molecular formula C20H33N5O5S and a molecular weight of 455.58 g/mol. Its IUPAC name is (2S,3R)-N-hydroxy-5-methyl-3-[[2-methylpropyl(methylsulfonyl)amino]carbamoyl]-2-(3-pyrimidin-5-ylprop-2-enyl)hexanamide.
| Compound Name | (2S,3R)-N-hydroxy-5-methyl-3-[[2-methylpropyl(methylsulfonyl)amino]carbamoyl]-2-(3-pyrimidin-5-ylprop-2-enyl)hexanamide |
|---|---|
| PubChem CID | 151789335 |
| Molecular Formula | C20H33N5O5S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | (2S,3R)-N-hydroxy-5-methyl-3-[[2-methylpropyl(methylsulfonyl)amino]carbamoyl]-2-(3-pyrimidin-5-ylprop-2-enyl)hexanamide |
| SMILES | CC(C)C[C@@H](C(=O)NN(CC(C)C)S(C)(=O)=O)[C@H](CC=Cc1cncnc1)C(=O)NO |
| InChI | InChI=1S/C20H33N5O5S/c1-14(2)9-18(19(26)23-25(12-15(3)4)31(5,29)30)17(20(27)24-28)8-6-7-16-10-21-13-22-11-16/h6-7,10-11,13-15,17-18,28H,8-9,12H2,1-5H3,(H,23,26)(H,24,27)/t17-,18+/m0/s1 |
| InChIKey | RWHCCCGERDJLCX-ZWKOTPCHSA-N |
| XLogP | 1.61 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|