C24H37ClN2O5S — CID 86756751
tert-butyl (2S,3R)-3-[(3-chloropropylsulfonylamino)carbamoyl]-5-methyl-2-[(E)-3-phenylprop-2-enyl]hexanoate (PubChem CID 86756751) has the molecular formula C24H37ClN2O5S and a molecular weight of 501.09 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-[(3-chloropropylsulfonylamino)carbamoyl]-5-methyl-2-[(E)-3-phenylprop-2-enyl]hexanoate.
| Compound Name | tert-butyl (2S,3R)-3-[(3-chloropropylsulfonylamino)carbamoyl]-5-methyl-2-[(E)-3-phenylprop-2-enyl]hexanoate |
|---|---|
| PubChem CID | 86756751 |
| Molecular Formula | C24H37ClN2O5S |
| Molecular Weight | 501.09 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | tert-butyl (2S,3R)-3-[(3-chloropropylsulfonylamino)carbamoyl]-5-methyl-2-[(E)-3-phenylprop-2-enyl]hexanoate |
| SMILES | CC(C)C[C@@H](C(=O)NNS(=O)(=O)CCCCl)[C@H](C/C=C/c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H37ClN2O5S/c1-18(2)17-21(22(28)26-27-33(30,31)16-10-15-25)20(23(29)32-24(3,4)5)14-9-13-19-11-7-6-8-12-19/h6-9,11-13,18,20-21,27H,10,14-17H2,1-5H3,(H,26,28)/b13-9+/t20-,21+/m0/s1 |
| InChIKey | VBSQKQMFYHTJLQ-WCWNVHNDSA-N |
| XLogP | 4.29 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.09 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|