C15H19NOS — CID 107035321
N-hex-5-yn-3-yl-3-phenyl-2-sulfanylpropanamide (PubChem CID 107035321) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is N-hex-5-yn-3-yl-3-phenyl-2-sulfanylpropanamide.
| Compound Name | N-hex-5-yn-3-yl-3-phenyl-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107035321 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-hex-5-yn-3-yl-3-phenyl-2-sulfanylpropanamide |
| SMILES | C#CCC(CC)NC(=O)C(S)Cc1ccccc1 |
| InChI | InChI=1S/C15H19NOS/c1-3-8-13(4-2)16-15(17)14(18)11-12-9-6-5-7-10-12/h1,5-7,9-10,13-14,18H,4,8,11H2,2H3,(H,16,17) |
| InChIKey | VQQASIVXKYEYCJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|