C16H24N2OS — CID 107036327
N-(1,3-dimethylpiperidin-4-yl)-3-phenyl-2-sulfanylpropanamide (PubChem CID 107036327) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-(1,3-dimethylpiperidin-4-yl)-3-phenyl-2-sulfanylpropanamide.
| Compound Name | N-(1,3-dimethylpiperidin-4-yl)-3-phenyl-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107036327 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-(1,3-dimethylpiperidin-4-yl)-3-phenyl-2-sulfanylpropanamide |
| SMILES | CC1CN(C)CCC1NC(=O)C(S)Cc1ccccc1 |
| InChI | InChI=1S/C16H24N2OS/c1-12-11-18(2)9-8-14(12)17-16(19)15(20)10-13-6-4-3-5-7-13/h3-7,12,14-15,20H,8-11H2,1-2H3,(H,17,19) |
| InChIKey | UGSPSLHGTCLHTQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|