C11H12ClNOS — CID 107035066
N-(2-chloroprop-2-enyl)-2-(4-sulfanylphenyl)acetamide (PubChem CID 107035066) has the molecular formula C11H12ClNOS and a molecular weight of 241.74 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-2-(4-sulfanylphenyl)acetamide.
| Compound Name | N-(2-chloroprop-2-enyl)-2-(4-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 107035066 |
| Molecular Formula | C11H12ClNOS |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-2-(4-sulfanylphenyl)acetamide |
| SMILES | C=C(Cl)CNC(=O)Cc1ccc(S)cc1 |
| InChI | InChI=1S/C11H12ClNOS/c1-8(12)7-13-11(14)6-9-2-4-10(15)5-3-9/h2-5,15H,1,6-7H2,(H,13,14) |
| InChIKey | WJUWTGNLVMPCKJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|