C13H23N3O2S — CID 107769746
2-acetamido-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-sulfanylpropanamide (PubChem CID 107769746) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-acetamido-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769746 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-acetamido-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-sulfanylpropanamide |
| SMILES | CC(=O)NC(CS)C(=O)NC1CCN2CCCC2C1 |
| InChI | InChI=1S/C13H23N3O2S/c1-9(17)14-12(8-19)13(18)15-10-4-6-16-5-2-3-11(16)7-10/h10-12,19H,2-8H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | HAVFPKBYHUJAQM-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|