C13H24N2O2S — CID 107769000
2-acetamido-N-(2,3-dimethylcyclohexyl)-3-sulfanylpropanamide (PubChem CID 107769000) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is 2-acetamido-N-(2,3-dimethylcyclohexyl)-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-(2,3-dimethylcyclohexyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769000 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-acetamido-N-(2,3-dimethylcyclohexyl)-3-sulfanylpropanamide |
| SMILES | CC(=O)NC(CS)C(=O)NC1CCCC(C)C1C |
| InChI | InChI=1S/C13H24N2O2S/c1-8-5-4-6-11(9(8)2)15-13(17)12(7-18)14-10(3)16/h8-9,11-12,18H,4-7H2,1-3H3,(H,14,16)(H,15,17) |
| InChIKey | TUFAKRQIUKMWHS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|