C15H27N3O3 — CID 103928209
(2R)-2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylcarbamoylamino)-3,3-dimethylbutanoic acid (PubChem CID 103928209) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2R)-2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylcarbamoylamino)-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylcarbamoylamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103928209 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (2R)-2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylcarbamoylamino)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@@H](NC(=O)NC1CCN2CCCC2C1)C(=O)O |
| InChI | InChI=1S/C15H27N3O3/c1-15(2,3)12(13(19)20)17-14(21)16-10-6-8-18-7-4-5-11(18)9-10/h10-12H,4-9H2,1-3H3,(H,19,20)(H2,16,17,21)/t10?,11?,12-/m0/s1 |
| InChIKey | BLSPFQUAITXZGD-MCIGGMRASA-N |
| XLogP | 1.41 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |