C20H31N3O2 — CID 124844383
1-[(7S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3-(2-methyl-1-phenylmethoxypropan-2-yl)urea (PubChem CID 124844383) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-[(7S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3-(2-methyl-1-phenylmethoxypropan-2-yl)urea.
| Compound Name | 1-[(7S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3-(2-methyl-1-phenylmethoxypropan-2-yl)urea |
|---|---|
| PubChem CID | 124844383 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 1-[(7S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3-(2-methyl-1-phenylmethoxypropan-2-yl)urea |
| SMILES | CC(C)(COCc1ccccc1)NC(=O)N[C@H]1CCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C20H31N3O2/c1-20(2,15-25-14-16-7-4-3-5-8-16)22-19(24)21-17-10-12-23-11-6-9-18(23)13-17/h3-5,7-8,17-18H,6,9-15H2,1-2H3,(H2,21,22,24)/t17-,18+/m0/s1 |
| InChIKey | GEYZLWLMUAZWTP-ZWKOTPCHSA-N |
| XLogP | 2.91 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |