C13H23N3O4 — CID 107840634
4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylcarbamoylamino)-2-hydroxybutanoic acid (PubChem CID 107840634) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylcarbamoylamino)-2-hydroxybutanoic acid.
| Compound Name | 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylcarbamoylamino)-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107840634 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylcarbamoylamino)-2-hydroxybutanoic acid |
| SMILES | O=C(NCCC(O)C(=O)O)NC1CCN2CCCC2C1 |
| InChI | InChI=1S/C13H23N3O4/c17-11(12(18)19)3-5-14-13(20)15-9-4-7-16-6-1-2-10(16)8-9/h9-11,17H,1-8H2,(H,18,19)(H2,14,15,20) |
| InChIKey | HFPJMHCCAPHYHK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |