C16H29N3OS — CID 119941128
N-(1-cyclopentylpiperidin-4-yl)-2-thiomorpholin-3-ylacetamide (PubChem CID 119941128) has the molecular formula C16H29N3OS and a molecular weight of 311.50 g/mol. Its IUPAC name is N-(1-cyclopentylpiperidin-4-yl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(1-cyclopentylpiperidin-4-yl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119941128 |
| Molecular Formula | C16H29N3OS |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-(1-cyclopentylpiperidin-4-yl)-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NC1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C16H29N3OS/c20-16(11-14-12-21-10-7-17-14)18-13-5-8-19(9-6-13)15-3-1-2-4-15/h13-15,17H,1-12H2,(H,18,20) |
| InChIKey | CWJWKEKQUQCSLB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |