C16H31N3O2S — CID 119942509
N-[1-(2-propan-2-yloxyethyl)piperidin-4-yl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119942509) has the molecular formula C16H31N3O2S and a molecular weight of 329.51 g/mol. Its IUPAC name is N-[1-(2-propan-2-yloxyethyl)piperidin-4-yl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[1-(2-propan-2-yloxyethyl)piperidin-4-yl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119942509 |
| Molecular Formula | C16H31N3O2S |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-[1-(2-propan-2-yloxyethyl)piperidin-4-yl]-2-thiomorpholin-3-ylacetamide |
| SMILES | CC(C)OCCN1CCC(NC(=O)CC2CSCCN2)CC1 |
| InChI | InChI=1S/C16H31N3O2S/c1-13(2)21-9-8-19-6-3-14(4-7-19)18-16(20)11-15-12-22-10-5-17-15/h13-15,17H,3-12H2,1-2H3,(H,18,20) |
| InChIKey | RUWVXNIJLMPPPX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |