C17H25N3O3S — CID 70696099
ethyl (1S,5S)-8-[2-(thiophene-2-carbonylamino)ethylamino]-3-azabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 70696099) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is ethyl (1S,5S)-8-[2-(thiophene-2-carbonylamino)ethylamino]-3-azabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | ethyl (1S,5S)-8-[2-(thiophene-2-carbonylamino)ethylamino]-3-azabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 70696099 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | ethyl (1S,5S)-8-[2-(thiophene-2-carbonylamino)ethylamino]-3-azabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CCOC(=O)N1C[C@@H]2CC[C@@H](C1)C2NCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C17H25N3O3S/c1-2-23-17(22)20-10-12-5-6-13(11-20)15(12)18-7-8-19-16(21)14-4-3-9-24-14/h3-4,9,12-13,15,18H,2,5-8,10-11H2,1H3,(H,19,21)/t12-,13-/m0/s1 |
| InChIKey | GONINSKKIDMHMG-STQMWFEESA-N |
| XLogP | 1.93 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|