C16H25N3O2S — CID 119647570
N-[3-[4-(ethylaminomethyl)piperidin-1-yl]-3-oxopropyl]thiophene-2-carboxamide (PubChem CID 119647570) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-[3-[4-(ethylaminomethyl)piperidin-1-yl]-3-oxopropyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[4-(ethylaminomethyl)piperidin-1-yl]-3-oxopropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119647570 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[3-[4-(ethylaminomethyl)piperidin-1-yl]-3-oxopropyl]thiophene-2-carboxamide |
| SMILES | CCNCC1CCN(C(=O)CCNC(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C16H25N3O2S/c1-2-17-12-13-6-9-19(10-7-13)15(20)5-8-18-16(21)14-4-3-11-22-14/h3-4,11,13,17H,2,5-10,12H2,1H3,(H,18,21) |
| InChIKey | LSNQJSREWNOFCV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |