C16H22N2O4S — CID 51180748
ethyl 1-[3-(thiophene-2-carbonylamino)propanoyl]piperidine-3-carboxylate (PubChem CID 51180748) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is ethyl 1-[3-(thiophene-2-carbonylamino)propanoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[3-(thiophene-2-carbonylamino)propanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 51180748 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | ethyl 1-[3-(thiophene-2-carbonylamino)propanoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)CCNC(=O)c2cccs2)C1 |
| InChI | InChI=1S/C16H22N2O4S/c1-2-22-16(21)12-5-3-9-18(11-12)14(19)7-8-17-15(20)13-6-4-10-23-13/h4,6,10,12H,2-3,5,7-9,11H2,1H3,(H,17,20) |
| InChIKey | MMHFCJOCCRLKCI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |