C18H19F3N2O3 — CID 95729637
1-[(3S)-3-[3-(trifluoromethyl)benzoyl]piperidine-1-carbonyl]cyclopropane-1-carboxamide (PubChem CID 95729637) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is 1-[(3S)-3-[3-(trifluoromethyl)benzoyl]piperidine-1-carbonyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[(3S)-3-[3-(trifluoromethyl)benzoyl]piperidine-1-carbonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95729637 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-[(3S)-3-[3-(trifluoromethyl)benzoyl]piperidine-1-carbonyl]cyclopropane-1-carboxamide |
| SMILES | NC(=O)C1(C(=O)N2CCC[C@H](C(=O)c3cccc(C(F)(F)F)c3)C2)CC1 |
| InChI | InChI=1S/C18H19F3N2O3/c19-18(20,21)13-5-1-3-11(9-13)14(24)12-4-2-8-23(10-12)16(26)17(6-7-17)15(22)25/h1,3,5,9,12H,2,4,6-8,10H2,(H2,22,25)/t12-/m0/s1 |
| InChIKey | KSUJIRZSJDCENB-LBPRGKRZSA-N |
| XLogP | 2.39 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|