C16H20F3NO3S — CID 45188055
(1-propan-2-ylsulfonylpiperidin-3-yl)-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 45188055) has the molecular formula C16H20F3NO3S and a molecular weight of 363.40 g/mol. Its IUPAC name is (1-propan-2-ylsulfonylpiperidin-3-yl)-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | (1-propan-2-ylsulfonylpiperidin-3-yl)-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 45188055 |
| Molecular Formula | C16H20F3NO3S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (1-propan-2-ylsulfonylpiperidin-3-yl)-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC(C)S(=O)(=O)N1CCCC(C(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H20F3NO3S/c1-11(2)24(22,23)20-8-4-6-13(10-20)15(21)12-5-3-7-14(9-12)16(17,18)19/h3,5,7,9,11,13H,4,6,8,10H2,1-2H3 |
| InChIKey | KNZVAIUPAMWMMM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |