C21H19F3N2O2 — CID 45185730
(E)-3-pyridin-2-yl-1-[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 45185730) has the molecular formula C21H19F3N2O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is (E)-3-pyridin-2-yl-1-[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-pyridin-2-yl-1-[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 45185730 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (E)-3-pyridin-2-yl-1-[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)C1CCCN(C(=O)/C=C/c2ccccn2)C1 |
| InChI | InChI=1S/C21H19F3N2O2/c22-21(23,24)17-7-3-5-15(13-17)20(28)16-6-4-12-26(14-16)19(27)10-9-18-8-1-2-11-25-18/h1-3,5,7-11,13,16H,4,6,12,14H2/b10-9+ |
| InChIKey | BIKTXPMYLWULST-MDZDMXLPSA-N |
| XLogP | 4.24 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|