C20H27NO5 — CID 42245196
methyl 5-[(3R)-3-(4-methoxy-2-methylbenzoyl)piperidin-1-yl]-5-oxopentanoate (PubChem CID 42245196) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is methyl 5-[(3R)-3-(4-methoxy-2-methylbenzoyl)piperidin-1-yl]-5-oxopentanoate.
| Compound Name | methyl 5-[(3R)-3-(4-methoxy-2-methylbenzoyl)piperidin-1-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 42245196 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | methyl 5-[(3R)-3-(4-methoxy-2-methylbenzoyl)piperidin-1-yl]-5-oxopentanoate |
| SMILES | COC(=O)CCCC(=O)N1CCC[C@@H](C(=O)c2ccc(OC)cc2C)C1 |
| InChI | InChI=1S/C20H27NO5/c1-14-12-16(25-2)9-10-17(14)20(24)15-6-5-11-21(13-15)18(22)7-4-8-19(23)26-3/h9-10,12,15H,4-8,11,13H2,1-3H3/t15-/m1/s1 |
| InChIKey | VEKSJJALYQCZGS-OAHLLOKOSA-N |
| XLogP | 2.77 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |