C16H21F3N2O — CID 119379948
1-(3-aminopiperidin-1-yl)-2-methyl-2-[3-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 119379948) has the molecular formula C16H21F3N2O and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-(3-aminopiperidin-1-yl)-2-methyl-2-[3-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 1-(3-aminopiperidin-1-yl)-2-methyl-2-[3-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 119379948 |
| Molecular Formula | C16H21F3N2O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-(3-aminopiperidin-1-yl)-2-methyl-2-[3-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | CC(C)(C(=O)N1CCCC(N)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N2O/c1-15(2,14(22)21-8-4-7-13(20)10-21)11-5-3-6-12(9-11)16(17,18)19/h3,5-6,9,13H,4,7-8,10,20H2,1-2H3 |
| InChIKey | ONFGMRNRDCTOQZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |