C29H41N3O — CID 100705836
1-[[2-[[[(3aR,4R,8aR)-2-benzyl-3,3a,4,5,6,7,8,8a-octahydro-1H-cyclohepta[c]pyrrol-4-yl]amino]methyl]phenyl]methyl]piperidin-4-ol (PubChem CID 100705836) has the molecular formula C29H41N3O and a molecular weight of 447.67 g/mol. Its IUPAC name is 1-[[2-[[[(3aR,4R,8aR)-2-benzyl-3,3a,4,5,6,7,8,8a-octahydro-1H-cyclohepta[c]pyrrol-4-yl]amino]methyl]phenyl]methyl]piperidin-4-ol.
| Compound Name | 1-[[2-[[[(3aR,4R,8aR)-2-benzyl-3,3a,4,5,6,7,8,8a-octahydro-1H-cyclohepta[c]pyrrol-4-yl]amino]methyl]phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 100705836 |
| Molecular Formula | C29H41N3O |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.32 |
| IUPAC Name | 1-[[2-[[[(3aR,4R,8aR)-2-benzyl-3,3a,4,5,6,7,8,8a-octahydro-1H-cyclohepta[c]pyrrol-4-yl]amino]methyl]phenyl]methyl]piperidin-4-ol |
| SMILES | OC1CCN(Cc2ccccc2CN[C@@H]2CCCC[C@H]3CN(Cc4ccccc4)C[C@@H]32)CC1 |
| InChI | InChI=1S/C29H41N3O/c33-27-14-16-31(17-15-27)20-25-11-5-4-10-24(25)18-30-29-13-7-6-12-26-21-32(22-28(26)29)19-23-8-2-1-3-9-23/h1-5,8-11,26-30,33H,6-7,12-22H2/t26-,28-,29+/m0/s1 |
| InChIKey | BOLHZOHEUOVICL-PIZZNKLWSA-N |
| XLogP | 4.42 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |