C14H20N4OS — CID 115675555
2-[4-[(5-cyanothiophen-2-yl)methylamino]piperidin-1-yl]-N-methylacetamide (PubChem CID 115675555) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-[4-[(5-cyanothiophen-2-yl)methylamino]piperidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[(5-cyanothiophen-2-yl)methylamino]piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 115675555 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[4-[(5-cyanothiophen-2-yl)methylamino]piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(NCc2ccc(C#N)s2)CC1 |
| InChI | InChI=1S/C14H20N4OS/c1-16-14(19)10-18-6-4-11(5-7-18)17-9-13-3-2-12(8-15)20-13/h2-3,11,17H,4-7,9-10H2,1H3,(H,16,19) |
| InChIKey | SKRBNDNHNAOVBF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |