C16H21N3O2S — CID 129490029
(2S)-2-[1-[(5-cyanothiophen-2-yl)methyl]piperidin-4-yl]-N-cyclopropyl-2-hydroxyacetamide (PubChem CID 129490029) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is (2S)-2-[1-[(5-cyanothiophen-2-yl)methyl]piperidin-4-yl]-N-cyclopropyl-2-hydroxyacetamide.
| Compound Name | (2S)-2-[1-[(5-cyanothiophen-2-yl)methyl]piperidin-4-yl]-N-cyclopropyl-2-hydroxyacetamide |
|---|---|
| PubChem CID | 129490029 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (2S)-2-[1-[(5-cyanothiophen-2-yl)methyl]piperidin-4-yl]-N-cyclopropyl-2-hydroxyacetamide |
| SMILES | N#Cc1ccc(CN2CCC([C@H](O)C(=O)NC3CC3)CC2)s1 |
| InChI | InChI=1S/C16H21N3O2S/c17-9-13-3-4-14(22-13)10-19-7-5-11(6-8-19)15(20)16(21)18-12-1-2-12/h3-4,11-12,15,20H,1-2,5-8,10H2,(H,18,21)/t15-/m0/s1 |
| InChIKey | NARJBQYMFPWMMK-HNNXBMFYSA-N |
| XLogP | 1.47 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |