About [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate
[2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate (PubChem CID 55102737) has the molecular formula C13H17FN2O3
and a molecular weight of 268.29 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate.
Molecular Properties
| Compound Name | [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate |
| PubChem CID | 55102737 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate |
| SMILES | CCN(CC)C(=O)COC(=O)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C13H17FN2O3/c1-3-16(4-2)12(17)8-19-13(18)9-5-6-11(15)10(14)7-9/h5-7H,3-4,8,15H2,1-2H3 |
| InChIKey | ZMDFLGUYEKLAFU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate?
The IUPAC name of [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate (CID 55102737) is [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate.
What is the SMILES notation for [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate?
The canonical SMILES for [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate is CCN(CC)C(=O)COC(=O)c1ccc(N)c(F)c1.
What is the InChIKey of [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate?
The InChIKey is ZMDFLGUYEKLAFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FN2O3/c1-3-16(4-2)12(17)8-19-13(18)9-5-6-11(15)10(14)7-9/h5-7H,3-4,8,15H2,1-2H3.
What are the key properties of [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate?
[2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate has a molecular weight of 268.29 g/mol, XLogP of 1.43, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(diethylamino)-2-oxoethyl] 4-amino-3-fluorobenzoate is sourced from PubChem (CID 55102737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).