C14H18FNO3 — CID 65469618
3-fluoro-4-[(1-methylpiperidin-2-yl)methoxy]benzoic acid (PubChem CID 65469618) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 3-fluoro-4-[(1-methylpiperidin-2-yl)methoxy]benzoic acid.
| Compound Name | 3-fluoro-4-[(1-methylpiperidin-2-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 65469618 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-fluoro-4-[(1-methylpiperidin-2-yl)methoxy]benzoic acid |
| SMILES | CN1CCCCC1COc1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C14H18FNO3/c1-16-7-3-2-4-11(16)9-19-13-6-5-10(14(17)18)8-12(13)15/h5-6,8,11H,2-4,7,9H2,1H3,(H,17,18) |
| InChIKey | UASDPQGBYZZXKD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |