C19H24F4N2O2 — CID 126600929
1-[(3aR,8aS)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-6-yl]-3-[2-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]propan-1-one (PubChem CID 126600929) has the molecular formula C19H24F4N2O2 and a molecular weight of 388.41 g/mol. Its IUPAC name is 1-[(3aR,8aS)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-6-yl]-3-[2-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]propan-1-one.
| Compound Name | 1-[(3aR,8aS)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-6-yl]-3-[2-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]propan-1-one |
|---|---|
| PubChem CID | 126600929 |
| Molecular Formula | C19H24F4N2O2 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-[(3aR,8aS)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-6-yl]-3-[2-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]propan-1-one |
| SMILES | O=C(CCc1ccc(OCC(F)(F)F)cc1F)N1CC[C@@H]2CNC[C@@H]2CC1 |
| InChI | InChI=1S/C19H24F4N2O2/c20-17-9-16(27-12-19(21,22)23)3-1-13(17)2-4-18(26)25-7-5-14-10-24-11-15(14)6-8-25/h1,3,9,14-15,24H,2,4-8,10-12H2/t14-,15+ |
| InChIKey | IWHAFMNTUJNSMG-GASCZTMLSA-N |
| XLogP | 3.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |