C18H24ClF3N2O3 — CID 120659217
1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propan-1-one;hydrochloride (PubChem CID 120659217) has the molecular formula C18H24ClF3N2O3 and a molecular weight of 408.85 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propan-1-one;hydrochloride.
| Compound Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120659217 |
| Molecular Formula | C18H24ClF3N2O3 |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propan-1-one;hydrochloride |
| SMILES | COc1cc(CCC(=O)N2C[C@H]3CNC[C@H]3C2)ccc1OCC(F)(F)F.Cl |
| InChI | InChI=1S/C18H23F3N2O3.ClH/c1-25-16-6-12(2-4-15(16)26-11-18(19,20)21)3-5-17(24)23-9-13-7-22-8-14(13)10-23;/h2,4,6,13-14,22H,3,5,7-11H2,1H3;1H/t13-,14+; |
| InChIKey | ZTZSXUOXIXPHBR-KAECKJJSSA-N |
| XLogP | 2.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |