C16H21Cl2F3N2O2 — CID 118599221
1-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[4-(trifluoromethoxy)phenyl]propan-1-one;dihydrochloride (PubChem CID 118599221) has the molecular formula C16H21Cl2F3N2O2 and a molecular weight of 401.26 g/mol. Its IUPAC name is 1-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[4-(trifluoromethoxy)phenyl]propan-1-one;dihydrochloride.
| Compound Name | 1-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[4-(trifluoromethoxy)phenyl]propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 118599221 |
| Molecular Formula | C16H21Cl2F3N2O2 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[4-(trifluoromethoxy)phenyl]propan-1-one;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCc1ccc(OC(F)(F)F)cc1)N1C[C@@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C16H19F3N2O2.2ClH/c17-16(18,19)23-14-4-1-11(2-5-14)3-6-15(22)21-9-12-7-20-8-13(12)10-21;;/h1-2,4-5,12-13,20H,3,6-10H2;2*1H/t12-,13-;;/m0../s1 |
| InChIKey | UWYVHKUOAKEHQU-NJHZPMQHSA-N |
| XLogP | 3.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |