C16H18F3NO5 — CID 119251700
4-hydroxy-1-[3-[4-(trifluoromethoxy)phenyl]propanoyl]piperidine-4-carboxylic acid (PubChem CID 119251700) has the molecular formula C16H18F3NO5 and a molecular weight of 361.32 g/mol. Its IUPAC name is 4-hydroxy-1-[3-[4-(trifluoromethoxy)phenyl]propanoyl]piperidine-4-carboxylic acid.
| Compound Name | 4-hydroxy-1-[3-[4-(trifluoromethoxy)phenyl]propanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251700 |
| Molecular Formula | C16H18F3NO5 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 4-hydroxy-1-[3-[4-(trifluoromethoxy)phenyl]propanoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(CCc1ccc(OC(F)(F)F)cc1)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C16H18F3NO5/c17-16(18,19)25-12-4-1-11(2-5-12)3-6-13(21)20-9-7-15(24,8-10-20)14(22)23/h1-2,4-5,24H,3,6-10H2,(H,22,23) |
| InChIKey | SVLFZBZVLUJJJP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |