C18H25F3N2O2 — CID 119647269
1-[4-(ethylaminomethyl)piperidin-1-yl]-3-[4-(trifluoromethoxy)phenyl]propan-1-one (PubChem CID 119647269) has the molecular formula C18H25F3N2O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-[4-(ethylaminomethyl)piperidin-1-yl]-3-[4-(trifluoromethoxy)phenyl]propan-1-one.
| Compound Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-3-[4-(trifluoromethoxy)phenyl]propan-1-one |
|---|---|
| PubChem CID | 119647269 |
| Molecular Formula | C18H25F3N2O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-3-[4-(trifluoromethoxy)phenyl]propan-1-one |
| SMILES | CCNCC1CCN(C(=O)CCc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H25F3N2O2/c1-2-22-13-15-9-11-23(12-10-15)17(24)8-5-14-3-6-16(7-4-14)25-18(19,20)21/h3-4,6-7,15,22H,2,5,8-13H2,1H3 |
| InChIKey | USHWBKDQIZHYJB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |